C23H32F2N6O — CID 151761176
6-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4-difluoro-3-[2-[(2R)-2-propan-2-ylmorpholin-4-yl]pyrimidin-4-yl]aniline (PubChem CID 151761176) has the molecular formula C23H32F2N6O and a molecular weight of 446.55 g/mol. Its IUPAC name is 6-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4-difluoro-3-[2-[(2R)-2-propan-2-ylmorpholin-4-yl]pyrimidin-4-yl]aniline.
| Compound Name | 6-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4-difluoro-3-[2-[(2R)-2-propan-2-ylmorpholin-4-yl]pyrimidin-4-yl]aniline |
|---|---|
| PubChem CID | 151761176 |
| Molecular Formula | C23H32F2N6O |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 6-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4-difluoro-3-[2-[(2R)-2-propan-2-ylmorpholin-4-yl]pyrimidin-4-yl]aniline |
| SMILES | CC(C)[C@@H]1CN(c2nccc(-c3c(F)cc(N4CCN(C)[C@@H](C)C4)c(N)c3F)n2)CCO1 |
| InChI | InChI=1S/C23H32F2N6O/c1-14(2)19-13-31(9-10-32-19)23-27-6-5-17(28-23)20-16(24)11-18(22(26)21(20)25)30-8-7-29(4)15(3)12-30/h5-6,11,14-15,19H,7-10,12-13,26H2,1-4H3/t15-,19-/m0/s1 |
| InChIKey | RQPDLRBCQDXGEW-KXBFYZLASA-N |
| XLogP | 3.01 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|