C19H27FN6 — CID 169052036
4-[5-amino-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-N,N-dimethylpyrimidin-2-amine (PubChem CID 169052036) has the molecular formula C19H27FN6 and a molecular weight of 358.47 g/mol. Its IUPAC name is 4-[5-amino-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 4-[5-amino-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 169052036 |
| Molecular Formula | C19H27FN6 |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 4-[5-amino-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-N,N-dimethylpyrimidin-2-amine |
| SMILES | C[C@@H]1CN(c2cc(F)c(-c3ccnc(N(C)C)n3)cc2N)C[C@H](C)N1C |
| InChI | InChI=1S/C19H27FN6/c1-12-10-26(11-13(2)25(12)5)18-9-15(20)14(8-16(18)21)17-6-7-22-19(23-17)24(3)4/h6-9,12-13H,10-11,21H2,1-5H3/t12-,13+ |
| InChIKey | PJISPSUSSODECY-BETUJISGSA-N |
| XLogP | 2.46 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|