C16H21FN4S — CID 159141750
4-fluoro-5-(1,3-thiazol-4-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]aniline (PubChem CID 159141750) has the molecular formula C16H21FN4S and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-fluoro-5-(1,3-thiazol-4-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]aniline.
| Compound Name | 4-fluoro-5-(1,3-thiazol-4-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]aniline |
|---|---|
| PubChem CID | 159141750 |
| Molecular Formula | C16H21FN4S |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-fluoro-5-(1,3-thiazol-4-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]aniline |
| SMILES | C[C@@H]1CN(c2cc(F)c(-c3cscn3)cc2N)C[C@H](C)N1C |
| InChI | InChI=1S/C16H21FN4S/c1-10-6-21(7-11(2)20(10)3)16-5-13(17)12(4-14(16)18)15-8-22-9-19-15/h4-5,8-11H,6-7,18H2,1-3H3/t10-,11+ |
| InChIKey | RKCOXARZGXRFLG-PHIMTYICSA-N |
| XLogP | 3.06 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|