C22H32N6O2 — CID 138541974
4-methoxy-5-(2-morpholin-4-ylpyrimidin-5-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]aniline (PubChem CID 138541974) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 4-methoxy-5-(2-morpholin-4-ylpyrimidin-5-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]aniline.
| Compound Name | 4-methoxy-5-(2-morpholin-4-ylpyrimidin-5-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]aniline |
|---|---|
| PubChem CID | 138541974 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 4-methoxy-5-(2-morpholin-4-ylpyrimidin-5-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]aniline |
| SMILES | COc1cc(N2C[C@@H](C)N(C)[C@@H](C)C2)c(N)cc1-c1cnc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C22H32N6O2/c1-15-13-28(14-16(2)26(15)3)20-10-21(29-4)18(9-19(20)23)17-11-24-22(25-12-17)27-5-7-30-8-6-27/h9-12,15-16H,5-8,13-14,23H2,1-4H3/t15-,16+ |
| InChIKey | CFZPNTLYIHKTKL-IYBDPMFKSA-N |
| XLogP | 2.10 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|