C21H27FN6O — CID 137376970
2-(4-cyclopropylpiperazin-1-yl)-4-fluoro-5-(2-morpholin-4-ylpyrimidin-5-yl)aniline (PubChem CID 137376970) has the molecular formula C21H27FN6O and a molecular weight of 398.49 g/mol. Its IUPAC name is 2-(4-cyclopropylpiperazin-1-yl)-4-fluoro-5-(2-morpholin-4-ylpyrimidin-5-yl)aniline.
| Compound Name | 2-(4-cyclopropylpiperazin-1-yl)-4-fluoro-5-(2-morpholin-4-ylpyrimidin-5-yl)aniline |
|---|---|
| PubChem CID | 137376970 |
| Molecular Formula | C21H27FN6O |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-(4-cyclopropylpiperazin-1-yl)-4-fluoro-5-(2-morpholin-4-ylpyrimidin-5-yl)aniline |
| SMILES | Nc1cc(-c2cnc(N3CCOCC3)nc2)c(F)cc1N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C21H27FN6O/c22-18-12-20(27-5-3-26(4-6-27)16-1-2-16)19(23)11-17(18)15-13-24-21(25-14-15)28-7-9-29-10-8-28/h11-14,16H,1-10,23H2 |
| InChIKey | SDPYXTZFACUOTJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|