C20H27ClN6O — CID 138542397
4-chloro-2-(3,4-dimethylpiperazin-1-yl)-5-(2-morpholin-4-ylpyrimidin-5-yl)aniline (PubChem CID 138542397) has the molecular formula C20H27ClN6O and a molecular weight of 402.93 g/mol. Its IUPAC name is 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-5-(2-morpholin-4-ylpyrimidin-5-yl)aniline.
| Compound Name | 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-5-(2-morpholin-4-ylpyrimidin-5-yl)aniline |
|---|---|
| PubChem CID | 138542397 |
| Molecular Formula | C20H27ClN6O |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-5-(2-morpholin-4-ylpyrimidin-5-yl)aniline |
| SMILES | CC1CN(c2cc(Cl)c(-c3cnc(N4CCOCC4)nc3)cc2N)CCN1C |
| InChI | InChI=1S/C20H27ClN6O/c1-14-13-27(4-3-25(14)2)19-10-17(21)16(9-18(19)22)15-11-23-20(24-12-15)26-5-7-28-8-6-26/h9-12,14H,3-8,13,22H2,1-2H3 |
| InChIKey | BEFMQNLJISCFRP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|