C20H25FN6O3 — CID 138542455
[1-[2-amino-5-fluoro-4-(2-morpholin-4-ylpyrimidin-5-yl)phenyl]pyrrolidin-3-yl]methyl carbamate (PubChem CID 138542455) has the molecular formula C20H25FN6O3 and a molecular weight of 416.46 g/mol. Its IUPAC name is [1-[2-amino-5-fluoro-4-(2-morpholin-4-ylpyrimidin-5-yl)phenyl]pyrrolidin-3-yl]methyl carbamate.
| Compound Name | [1-[2-amino-5-fluoro-4-(2-morpholin-4-ylpyrimidin-5-yl)phenyl]pyrrolidin-3-yl]methyl carbamate |
|---|---|
| PubChem CID | 138542455 |
| Molecular Formula | C20H25FN6O3 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | [1-[2-amino-5-fluoro-4-(2-morpholin-4-ylpyrimidin-5-yl)phenyl]pyrrolidin-3-yl]methyl carbamate |
| SMILES | NC(=O)OCC1CCN(c2cc(F)c(-c3cnc(N4CCOCC4)nc3)cc2N)C1 |
| InChI | InChI=1S/C20H25FN6O3/c21-16-8-18(27-2-1-13(11-27)12-30-19(23)28)17(22)7-15(16)14-9-24-20(25-10-14)26-3-5-29-6-4-26/h7-10,13H,1-6,11-12,22H2,(H2,23,28) |
| InChIKey | GHJRPQUQDPGUSF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|