C21H29FN6O — CID 137377451
4-fluoro-5-(2-morpholin-4-ylpyrimidin-5-yl)-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]aniline (PubChem CID 137377451) has the molecular formula C21H29FN6O and a molecular weight of 400.50 g/mol. Its IUPAC name is 4-fluoro-5-(2-morpholin-4-ylpyrimidin-5-yl)-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]aniline.
| Compound Name | 4-fluoro-5-(2-morpholin-4-ylpyrimidin-5-yl)-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]aniline |
|---|---|
| PubChem CID | 137377451 |
| Molecular Formula | C21H29FN6O |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 4-fluoro-5-(2-morpholin-4-ylpyrimidin-5-yl)-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]aniline |
| SMILES | C[C@@H]1CN(c2cc(F)c(-c3cnc(N4CCOCC4)nc3)cc2N)C[C@H](C)N1C |
| InChI | InChI=1S/C21H29FN6O/c1-14-12-28(13-15(2)26(14)3)20-9-18(22)17(8-19(20)23)16-10-24-21(25-11-16)27-4-6-29-7-5-27/h8-11,14-15H,4-7,12-13,23H2,1-3H3/t14-,15+ |
| InChIKey | HZSONYUBIPVWAI-GASCZTMLSA-N |
| XLogP | 2.23 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|