C21H32F2N6O — CID 160861035
5-[3-amino-2,6-difluoro-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]pyrimidin-2-amine;ethoxyethane (PubChem CID 160861035) has the molecular formula C21H32F2N6O and a molecular weight of 422.52 g/mol. Its IUPAC name is 5-[3-amino-2,6-difluoro-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]pyrimidin-2-amine;ethoxyethane.
| Compound Name | 5-[3-amino-2,6-difluoro-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]pyrimidin-2-amine;ethoxyethane |
|---|---|
| PubChem CID | 160861035 |
| Molecular Formula | C21H32F2N6O |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 5-[3-amino-2,6-difluoro-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]pyrimidin-2-amine;ethoxyethane |
| SMILES | CCOCC.C[C@@H]1CN(c2cc(F)c(-c3cnc(N)nc3)c(F)c2N)C[C@H](C)N1C |
| InChI | InChI=1S/C17H22F2N6.C4H10O/c1-9-7-25(8-10(2)24(9)3)13-4-12(18)14(15(19)16(13)20)11-5-22-17(21)23-6-11;1-3-5-4-2/h4-6,9-10H,7-8,20H2,1-3H3,(H2,21,22,23);3-4H2,1-2H3/t9-,10+; |
| InChIKey | SKMGZGGEHUMCOD-JMVWIVNTSA-N |
| XLogP | 3.16 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|