C15H24F6O3 — CID 151772322
5,7-bis(2,2,2-trifluoro-1-hydroxyethyl)undecan-6-one (PubChem CID 151772322) has the molecular formula C15H24F6O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is 5,7-bis(2,2,2-trifluoro-1-hydroxyethyl)undecan-6-one.
| Compound Name | 5,7-bis(2,2,2-trifluoro-1-hydroxyethyl)undecan-6-one |
|---|---|
| PubChem CID | 151772322 |
| Molecular Formula | C15H24F6O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 5,7-bis(2,2,2-trifluoro-1-hydroxyethyl)undecan-6-one |
| SMILES | CCCCC(C(=O)C(CCCC)C(O)C(F)(F)F)C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24F6O3/c1-3-5-7-9(12(23)14(16,17)18)11(22)10(8-6-4-2)13(24)15(19,20)21/h9-10,12-13,23-24H,3-8H2,1-2H3 |
| InChIKey | RSVLKLIWMBKQAO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |