C18H21O3P — CID 151785998
4-ethyl-2-phenoxy-4-(2,4,6-trimethylphenyl)-1,3,2-dioxaphosphetane (PubChem CID 151785998) has the molecular formula C18H21O3P and a molecular weight of 316.34 g/mol. Its IUPAC name is 4-ethyl-2-phenoxy-4-(2,4,6-trimethylphenyl)-1,3,2-dioxaphosphetane.
| Compound Name | 4-ethyl-2-phenoxy-4-(2,4,6-trimethylphenyl)-1,3,2-dioxaphosphetane |
|---|---|
| PubChem CID | 151785998 |
| Molecular Formula | C18H21O3P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-ethyl-2-phenoxy-4-(2,4,6-trimethylphenyl)-1,3,2-dioxaphosphetane |
| SMILES | CCC1(c2c(C)cc(C)cc2C)OP(Oc2ccccc2)O1 |
| InChI | InChI=1S/C18H21O3P/c1-5-18(17-14(3)11-13(2)12-15(17)4)20-22(21-18)19-16-9-7-6-8-10-16/h6-12H,5H2,1-4H3 |
| InChIKey | RVPLDXSJCBPODU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|