C20H24Zr — CID 151787229
1H-inden-1-ide;2-propan-2-ylcyclopenta-1,3-diene;propan-2-ylidenezirconium(2+) (PubChem CID 151787229) has the molecular formula C20H24Zr and a molecular weight of 355.64 g/mol. Its IUPAC name is 1H-inden-1-ide;2-propan-2-ylcyclopenta-1,3-diene;propan-2-ylidenezirconium(2+).
| Compound Name | 1H-inden-1-ide;2-propan-2-ylcyclopenta-1,3-diene;propan-2-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 151787229 |
| Molecular Formula | C20H24Zr |
| Molecular Weight | 355.64 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1H-inden-1-ide;2-propan-2-ylcyclopenta-1,3-diene;propan-2-ylidenezirconium(2+) |
| SMILES | CC(C)=[Zr+2].CC(C)c1cc[cH-]c1.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.C8H11.C3H6.Zr/c1-2-5-9-7-3-6-8(9)4-1;1-7(2)8-5-3-4-6-8;1-3-2;/h1-7H;3-7H,1-2H3;1-2H3;/q2*-1;;+2 |
| InChIKey | KSQGAPYCYVNLGZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|