C29H40O6 — CID 151787402
1-[5-but-1-enoxy-2-[2-[4-but-1-enoxy-2-(2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 151787402) has the molecular formula C29H40O6 and a molecular weight of 484.63 g/mol. Its IUPAC name is 1-[5-but-1-enoxy-2-[2-[4-but-1-enoxy-2-(2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1-[5-but-1-enoxy-2-[2-[4-but-1-enoxy-2-(2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 151787402 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 1-[5-but-1-enoxy-2-[2-[4-but-1-enoxy-2-(2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | CCC=COc1ccc(C(C)(C)c2ccc(OC=CCC)cc2OCC(C)O)c(OCC(C)O)c1 |
| InChI | InChI=1S/C29H40O6/c1-7-9-15-32-23-11-13-25(27(17-23)34-19-21(3)30)29(5,6)26-14-12-24(33-16-10-8-2)18-28(26)35-20-22(4)31/h9-18,21-22,30-31H,7-8,19-20H2,1-6H3 |
| InChIKey | RVXCTJJFSVQQFC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|