C23H28O4 — CID 67789753
4-ethenoxy-1-[2-(4-ethenoxy-2-ethoxyphenyl)propan-2-yl]-2-ethoxybenzene (PubChem CID 67789753) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-ethenoxy-1-[2-(4-ethenoxy-2-ethoxyphenyl)propan-2-yl]-2-ethoxybenzene.
| Compound Name | 4-ethenoxy-1-[2-(4-ethenoxy-2-ethoxyphenyl)propan-2-yl]-2-ethoxybenzene |
|---|---|
| PubChem CID | 67789753 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 4-ethenoxy-1-[2-(4-ethenoxy-2-ethoxyphenyl)propan-2-yl]-2-ethoxybenzene |
| SMILES | C=COc1ccc(C(C)(C)c2ccc(OC=C)cc2OCC)c(OCC)c1 |
| InChI | InChI=1S/C23H28O4/c1-7-24-17-11-13-19(21(15-17)26-9-3)23(5,6)20-14-12-18(25-8-2)16-22(20)27-10-4/h7-8,11-16H,1-2,9-10H2,3-6H3 |
| InChIKey | HQZJWJSLKYZOQT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|