C20H11F3O — CID 151791255
4-(2,3,4-trifluoro-9H-fluoren-1-yl)benzaldehyde (PubChem CID 151791255) has the molecular formula C20H11F3O and a molecular weight of 324.30 g/mol. Its IUPAC name is 4-(2,3,4-trifluoro-9H-fluoren-1-yl)benzaldehyde.
| Compound Name | 4-(2,3,4-trifluoro-9H-fluoren-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 151791255 |
| Molecular Formula | C20H11F3O |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-(2,3,4-trifluoro-9H-fluoren-1-yl)benzaldehyde |
| SMILES | O=Cc1ccc(-c2c(F)c(F)c(F)c3c2Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C20H11F3O/c21-18-16(12-7-5-11(10-24)6-8-12)15-9-13-3-1-2-4-14(13)17(15)19(22)20(18)23/h1-8,10H,9H2 |
| InChIKey | RWQXHAHRXYRIOY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|