About 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine
9H-fluorene-2-carbaldehyde;N-methylhydroxylamine (PubChem CID 156719252) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine.
Molecular Properties
| Compound Name | 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine |
| PubChem CID | 156719252 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine |
| SMILES | CNO.O=Cc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C14H10O.CH5NO/c15-9-10-5-6-14-12(7-10)8-11-3-1-2-4-13(11)14;1-2-3/h1-7,9H,8H2;2-3H,1H3 |
| InChIKey | XVSSNAJUUSEWGL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine?
The IUPAC name of 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine (CID 156719252) is 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine.
What is the SMILES notation for 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine?
The canonical SMILES for 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine is CNO.O=Cc1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine?
The InChIKey is XVSSNAJUUSEWGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O.CH5NO/c15-9-10-5-6-14-12(7-10)8-11-3-1-2-4-13(11)14;1-2-3/h1-7,9H,8H2;2-3H,1H3.
What are the key properties of 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine?
9H-fluorene-2-carbaldehyde;N-methylhydroxylamine has a molecular weight of 241.29 g/mol, XLogP of 2.67, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene-2-carbaldehyde;N-methylhydroxylamine is sourced from PubChem (CID 156719252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).