C20H26N2O7 — CID 151817990
2-acetyl-4-[3-methoxy-4-(phenylmethoxycarbonylamino)piperidin-1-yl]-4-oxobutanoic acid (PubChem CID 151817990) has the molecular formula C20H26N2O7 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-acetyl-4-[3-methoxy-4-(phenylmethoxycarbonylamino)piperidin-1-yl]-4-oxobutanoic acid.
| Compound Name | 2-acetyl-4-[3-methoxy-4-(phenylmethoxycarbonylamino)piperidin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 151817990 |
| Molecular Formula | C20H26N2O7 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-acetyl-4-[3-methoxy-4-(phenylmethoxycarbonylamino)piperidin-1-yl]-4-oxobutanoic acid |
| SMILES | COC1CN(C(=O)CC(C(C)=O)C(=O)O)CCC1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H26N2O7/c1-13(23)15(19(25)26)10-18(24)22-9-8-16(17(11-22)28-2)21-20(27)29-12-14-6-4-3-5-7-14/h3-7,15-17H,8-12H2,1-2H3,(H,21,27)(H,25,26) |
| InChIKey | SCAHLNRKBFGRLI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|