C6H7F2NO2 — CID 151819277
(2S)-4,4-difluoro-2-isocyanopentanoic acid (PubChem CID 151819277) has the molecular formula C6H7F2NO2 and a molecular weight of 163.12 g/mol. Its IUPAC name is (2S)-4,4-difluoro-2-isocyanopentanoic acid.
| Compound Name | (2S)-4,4-difluoro-2-isocyanopentanoic acid |
|---|---|
| PubChem CID | 151819277 |
| Molecular Formula | C6H7F2NO2 |
| Molecular Weight | 163.12 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | (2S)-4,4-difluoro-2-isocyanopentanoic acid |
| SMILES | [C-]#[N+][C@@H](CC(C)(F)F)C(=O)O |
| InChI | InChI=1S/C6H7F2NO2/c1-6(7,8)3-4(9-2)5(10)11/h4H,3H2,1H3,(H,10,11)/t4-/m0/s1 |
| InChIKey | SCGYTWDYNMTKAE-BYPYZUCNSA-N |
| XLogP | 1.40 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.12 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|