(2S)-4,4-difluoro-2-isocyanopentanoic acid

C6H7F2NO2 — CID 151819277

IUPAC(2S)-4,4-difluoro-2-isocyanopentanoic acid
SMILES[C-]#[N+][C@@H](CC(C)(F)F)C(=O)O
InChIInChI=1S/C6H7F2NO2/c1-6(7,8)3-4(9-2)5(10)11/h4H,3H2,1H3,(H,10,11)/t4-/m0/s1
InChIKeySCGYTWDYNMTKAE-BYPYZUCNSA-N
MW163.12 g/mol
LogP1.40
Rot. Bonds3

About (2S)-4,4-difluoro-2-isocyanopentanoic acid

(2S)-4,4-difluoro-2-isocyanopentanoic acid (PubChem CID 151819277) has the molecular formula C6H7F2NO2 and a molecular weight of 163.12 g/mol. Its IUPAC name is (2S)-4,4-difluoro-2-isocyanopentanoic acid.

Molecular Properties

Compound Name(2S)-4,4-difluoro-2-isocyanopentanoic acid
PubChem CID151819277
Molecular FormulaC6H7F2NO2
Molecular Weight163.12 g/mol
Exact Mass163.04
IUPAC Name(2S)-4,4-difluoro-2-isocyanopentanoic acid
SMILES[C-]#[N+][C@@H](CC(C)(F)F)C(=O)O
InChIInChI=1S/C6H7F2NO2/c1-6(7,8)3-4(9-2)5(10)11/h4H,3H2,1H3,(H,10,11)/t4-/m0/s1
InChIKeySCGYTWDYNMTKAE-BYPYZUCNSA-N
XLogP1.40
TPSA41.66 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.12
LogP ≤ 51.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze (2S)-4,4-difluoro-2-isocyanopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-4,4-difluoro-2-isocyanopentanoic acid?
The IUPAC name of (2S)-4,4-difluoro-2-isocyanopentanoic acid (CID 151819277) is (2S)-4,4-difluoro-2-isocyanopentanoic acid.
What is the SMILES notation for (2S)-4,4-difluoro-2-isocyanopentanoic acid?
The canonical SMILES for (2S)-4,4-difluoro-2-isocyanopentanoic acid is [C-]#[N+][C@@H](CC(C)(F)F)C(=O)O.
What is the InChIKey of (2S)-4,4-difluoro-2-isocyanopentanoic acid?
The InChIKey is SCGYTWDYNMTKAE-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H7F2NO2/c1-6(7,8)3-4(9-2)5(10)11/h4H,3H2,1H3,(H,10,11)/t4-/m0/s1.
What are the key properties of (2S)-4,4-difluoro-2-isocyanopentanoic acid?
(2S)-4,4-difluoro-2-isocyanopentanoic acid has a molecular weight of 163.12 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4,4-difluoro-2-isocyanopentanoic acid is sourced from PubChem (CID 151819277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).