C12H9NO — CID 15182293
4b,8a-dihydrocarbazol-3-one (PubChem CID 15182293) has the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. Its IUPAC name is 4b,8a-dihydrocarbazol-3-one.
| Compound Name | 4b,8a-dihydrocarbazol-3-one |
|---|---|
| PubChem CID | 15182293 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 4b,8a-dihydrocarbazol-3-one |
| SMILES | O=C1C=CC2=NC3C=CC=CC3C2=C1 |
| InChI | InChI=1S/C12H9NO/c14-8-5-6-12-10(7-8)9-3-1-2-4-11(9)13-12/h1-7,9,11H |
| InChIKey | ABOBYZANUYFTAY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|