C17H13NO — CID 90977563
10a,11-dihydro-5aH-benzo[b]acridin-4-one (PubChem CID 90977563) has the molecular formula C17H13NO and a molecular weight of 247.30 g/mol. Its IUPAC name is 10a,11-dihydro-5aH-benzo[b]acridin-4-one.
| Compound Name | 10a,11-dihydro-5aH-benzo[b]acridin-4-one |
|---|---|
| PubChem CID | 90977563 |
| Molecular Formula | C17H13NO |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 10a,11-dihydro-5aH-benzo[b]acridin-4-one |
| SMILES | O=C1C=CC=C2C=C3CC4C=CC=CC4=CC3N=C12 |
| InChI | InChI=1S/C17H13NO/c19-16-7-3-6-13-9-14-8-11-4-1-2-5-12(11)10-15(14)18-17(13)16/h1-7,9-11,15H,8H2 |
| InChIKey | IIAAEIDWDXZFPY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'} |
|---|