C13H11NO — CID 135047934
(4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one (PubChem CID 135047934) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one.
| Compound Name | (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one |
|---|---|
| PubChem CID | 135047934 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (4bS,8aS)-2-methyl-4b,8a-dihydrocarbazol-3-one |
| SMILES | CC1=CC2=N[C@H]3C=CC=C[C@H]3C2=CC1=O |
| InChI | InChI=1S/C13H11NO/c1-8-6-12-10(7-13(8)15)9-4-2-3-5-11(9)14-12/h2-7,9,11H,1H3/t9-,11-/m0/s1 |
| InChIKey | QEQKQXSSDXMUNH-ONGXEEELSA-N |
| XLogP | 2.01 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|