C15H15NO — CID 135047962
(4bS,8aS)-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one (PubChem CID 135047962) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is (4bS,8aS)-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one.
| Compound Name | (4bS,8aS)-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one |
|---|---|
| PubChem CID | 135047962 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (4bS,8aS)-1,2,4-trimethyl-4b,8a-dihydrocarbazol-3-one |
| SMILES | CC1=C(C)C2=N[C@H]3C=CC=C[C@H]3C2=C(C)C1=O |
| InChI | InChI=1S/C15H15NO/c1-8-9(2)15(17)10(3)13-11-6-4-5-7-12(11)16-14(8)13/h4-7,11-12H,1-3H3/t11-,12+/m1/s1 |
| InChIKey | FOCXNNSBAAWXNB-NEPJUHHUSA-N |
| XLogP | 2.79 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|