C25H24BFN2O5S — CID 151835217
[4-[(Z)-[5-fluoro-2-methyl-3-[2-oxo-2-(1,3-thiazol-2-ylmethylamino)ethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl]boronic acid (PubChem CID 151835217) has the molecular formula C25H24BFN2O5S and a molecular weight of 494.35 g/mol. Its IUPAC name is [4-[(Z)-[5-fluoro-2-methyl-3-[2-oxo-2-(1,3-thiazol-2-ylmethylamino)ethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl]boronic acid.
| Compound Name | [4-[(Z)-[5-fluoro-2-methyl-3-[2-oxo-2-(1,3-thiazol-2-ylmethylamino)ethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 151835217 |
| Molecular Formula | C25H24BFN2O5S |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [4-[(Z)-[5-fluoro-2-methyl-3-[2-oxo-2-(1,3-thiazol-2-ylmethylamino)ethyl]inden-1-ylidene]methyl]-2,6-dimethoxyphenyl]boronic acid |
| SMILES | COc1cc(/C=C2/C(C)=C(CC(=O)NCc3nccs3)c3cc(F)ccc32)cc(OC)c1B(O)O |
| InChI | InChI=1S/C25H24BFN2O5S/c1-14-18(8-15-9-21(33-2)25(26(31)32)22(10-15)34-3)17-5-4-16(27)11-20(17)19(14)12-23(30)29-13-24-28-6-7-35-24/h4-11,31-32H,12-13H2,1-3H3,(H,29,30)/b18-8- |
| InChIKey | SFMYGTCXWJNKDU-LSCVHKIXSA-N |
| XLogP | 3.01 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|