C15H18N4OS — CID 151838974
1,3-benzothiazol-5-yl(1,3,8-triazaspiro[4.5]decan-8-yl)methanone (PubChem CID 151838974) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 1,3-benzothiazol-5-yl(1,3,8-triazaspiro[4.5]decan-8-yl)methanone.
| Compound Name | 1,3-benzothiazol-5-yl(1,3,8-triazaspiro[4.5]decan-8-yl)methanone |
|---|---|
| PubChem CID | 151838974 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1,3-benzothiazol-5-yl(1,3,8-triazaspiro[4.5]decan-8-yl)methanone |
| SMILES | O=C(c1ccc2scnc2c1)N1CCC2(CC1)CNCN2 |
| InChI | InChI=1S/C15H18N4OS/c20-14(11-1-2-13-12(7-11)17-10-21-13)19-5-3-15(4-6-19)8-16-9-18-15/h1-2,7,10,16,18H,3-6,8-9H2 |
| InChIKey | SGGIVPGDWJTYNQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |