C16H22O4 — CID 151842105
6,7,8-trihydroxy-2,2-dimethyl-6-phenyloct-4-en-3-one (PubChem CID 151842105) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 6,7,8-trihydroxy-2,2-dimethyl-6-phenyloct-4-en-3-one.
| Compound Name | 6,7,8-trihydroxy-2,2-dimethyl-6-phenyloct-4-en-3-one |
|---|---|
| PubChem CID | 151842105 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 6,7,8-trihydroxy-2,2-dimethyl-6-phenyloct-4-en-3-one |
| SMILES | CC(C)(C)C(=O)C=CC(O)(c1ccccc1)C(O)CO |
| InChI | InChI=1S/C16H22O4/c1-15(2,3)13(18)9-10-16(20,14(19)11-17)12-7-5-4-6-8-12/h4-10,14,17,19-20H,11H2,1-3H3 |
| InChIKey | SGWRFDYVHAZAQR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|