C12H17BrN2O3S — CID 151865452
tert-butyl (6R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate (PubChem CID 151865452) has the molecular formula C12H17BrN2O3S and a molecular weight of 349.25 g/mol. Its IUPAC name is tert-butyl (6R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate.
| Compound Name | tert-butyl (6R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
|---|---|
| PubChem CID | 151865452 |
| Molecular Formula | C12H17BrN2O3S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | tert-butyl (6R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1S[C@@H]2C(N)C(=O)N2C=C1CBr |
| InChI | InChI=1S/C12H17BrN2O3S/c1-12(2,3)18-11(17)8-6(4-13)5-15-9(16)7(14)10(15)19-8/h5,7-8,10H,4,14H2,1-3H3/t7?,8?,10-/m1/s1 |
| InChIKey | SLOWHYFPPGXAKF-SFVIPPHHSA-N |
| XLogP | 1.22 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|