C14H19FN4O2 — CID 151875719
2-[(2-amino-5-fluoroquinazolin-4-yl)amino]hexane-1,3-diol (PubChem CID 151875719) has the molecular formula C14H19FN4O2 and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-[(2-amino-5-fluoroquinazolin-4-yl)amino]hexane-1,3-diol.
| Compound Name | 2-[(2-amino-5-fluoroquinazolin-4-yl)amino]hexane-1,3-diol |
|---|---|
| PubChem CID | 151875719 |
| Molecular Formula | C14H19FN4O2 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-[(2-amino-5-fluoroquinazolin-4-yl)amino]hexane-1,3-diol |
| SMILES | CCCC(O)C(CO)Nc1nc(N)nc2cccc(F)c12 |
| InChI | InChI=1S/C14H19FN4O2/c1-2-4-11(21)10(7-20)17-13-12-8(15)5-3-6-9(12)18-14(16)19-13/h3,5-6,10-11,20-21H,2,4,7H2,1H3,(H3,16,17,18,19) |
| InChIKey | SNQBSPUKOJQYEO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |