C16H22N2O — CID 151912060
5,5-dimethyl-4-methylidene-1-[3-(2-methylpropyl)phenyl]pyrazolidin-3-one (PubChem CID 151912060) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 5,5-dimethyl-4-methylidene-1-[3-(2-methylpropyl)phenyl]pyrazolidin-3-one.
| Compound Name | 5,5-dimethyl-4-methylidene-1-[3-(2-methylpropyl)phenyl]pyrazolidin-3-one |
|---|---|
| PubChem CID | 151912060 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 5,5-dimethyl-4-methylidene-1-[3-(2-methylpropyl)phenyl]pyrazolidin-3-one |
| SMILES | C=C1C(=O)NN(c2cccc(CC(C)C)c2)C1(C)C |
| InChI | InChI=1S/C16H22N2O/c1-11(2)9-13-7-6-8-14(10-13)18-16(4,5)12(3)15(19)17-18/h6-8,10-11H,3,9H2,1-2,4-5H3,(H,17,19) |
| InChIKey | SUZCFDFISFZYOJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|