C12H18N2O4 — CID 15192479
1-(5-oxido-4-pentanoyl-1,2,5-oxadiazol-5-ium-3-yl)pentan-1-one (PubChem CID 15192479) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-(5-oxido-4-pentanoyl-1,2,5-oxadiazol-5-ium-3-yl)pentan-1-one.
| Compound Name | 1-(5-oxido-4-pentanoyl-1,2,5-oxadiazol-5-ium-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 15192479 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-(5-oxido-4-pentanoyl-1,2,5-oxadiazol-5-ium-3-yl)pentan-1-one |
| SMILES | CCCCC(=O)c1no[n+]([O-])c1C(=O)CCCC |
| InChI | InChI=1S/C12H18N2O4/c1-3-5-7-9(15)11-12(14(17)18-13-11)10(16)8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | XLGAGKDJMFQHNF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|