About 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one
1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one (PubChem CID 21394862) has the molecular formula C20H34N2O4
and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one.
Molecular Properties
| Compound Name | 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one |
| PubChem CID | 21394862 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one |
| SMILES | CCCCCCCCC(=O)c1noc(CCCCCCCC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H34N2O4/c1-3-5-7-9-11-13-15-17(23)19-20(22(24)25)18(26-21-19)16-14-12-10-8-6-4-2/h3-16H2,1-2H3 |
| InChIKey | OMWUREXURBEZON-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one?
The IUPAC name of 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one (CID 21394862) is 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one.
What is the SMILES notation for 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one?
The canonical SMILES for 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one is CCCCCCCCC(=O)c1noc(CCCCCCCC)c1[N+](=O)[O-].
What is the InChIKey of 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one?
The InChIKey is OMWUREXURBEZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N2O4/c1-3-5-7-9-11-13-15-17(23)19-20(22(24)25)18(26-21-19)16-14-12-10-8-6-4-2/h3-16H2,1-2H3.
What are the key properties of 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one?
1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one has a molecular weight of 366.50 g/mol, XLogP of 6.42, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-nitro-5-octyl-1,2-oxazol-3-yl)nonan-1-one is sourced from PubChem (CID 21394862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).