C25H20F7NO2S — CID 151927781
2-[3-[4-fluoro-2-(trifluoromethyl)anilino]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-sulfanylpentanoic acid (PubChem CID 151927781) has the molecular formula C25H20F7NO2S and a molecular weight of 531.49 g/mol. Its IUPAC name is 2-[3-[4-fluoro-2-(trifluoromethyl)anilino]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-sulfanylpentanoic acid.
| Compound Name | 2-[3-[4-fluoro-2-(trifluoromethyl)anilino]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-sulfanylpentanoic acid |
|---|---|
| PubChem CID | 151927781 |
| Molecular Formula | C25H20F7NO2S |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | 2-[3-[4-fluoro-2-(trifluoromethyl)anilino]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-sulfanylpentanoic acid |
| SMILES | CC(S)CC(C(=O)O)c1cc(Nc2ccc(F)cc2C(F)(F)F)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C25H20F7NO2S/c1-13(36)8-20(23(34)35)16-9-15(14-2-4-17(5-3-14)24(27,28)29)10-19(11-16)33-22-7-6-18(26)12-21(22)25(30,31)32/h2-7,9-13,20,33,36H,8H2,1H3,(H,34,35) |
| InChIKey | SYDLVUKMBFTFNR-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|