C15H12ClN3O3 — CID 151928380
2-chloro-4-(4,6-dimethoxypyrimidin-2-yl)oxyquinoline (PubChem CID 151928380) has the molecular formula C15H12ClN3O3 and a molecular weight of 317.73 g/mol. Its IUPAC name is 2-chloro-4-(4,6-dimethoxypyrimidin-2-yl)oxyquinoline.
| Compound Name | 2-chloro-4-(4,6-dimethoxypyrimidin-2-yl)oxyquinoline |
|---|---|
| PubChem CID | 151928380 |
| Molecular Formula | C15H12ClN3O3 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-chloro-4-(4,6-dimethoxypyrimidin-2-yl)oxyquinoline |
| SMILES | COc1cc(OC)nc(Oc2cc(Cl)nc3ccccc23)n1 |
| InChI | InChI=1S/C15H12ClN3O3/c1-20-13-8-14(21-2)19-15(18-13)22-11-7-12(16)17-10-6-4-3-5-9(10)11/h3-8H,1-2H3 |
| InChIKey | SYGJWJHFZGWVII-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|