C18H35NO4 — CID 151928786
4-(2-isocyanatoethyl)-1,7-bis(2-methylpropoxy)heptan-4-ol (PubChem CID 151928786) has the molecular formula C18H35NO4 and a molecular weight of 329.48 g/mol. Its IUPAC name is 4-(2-isocyanatoethyl)-1,7-bis(2-methylpropoxy)heptan-4-ol.
| Compound Name | 4-(2-isocyanatoethyl)-1,7-bis(2-methylpropoxy)heptan-4-ol |
|---|---|
| PubChem CID | 151928786 |
| Molecular Formula | C18H35NO4 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 4-(2-isocyanatoethyl)-1,7-bis(2-methylpropoxy)heptan-4-ol |
| SMILES | CC(C)COCCCC(O)(CCCOCC(C)C)CCN=C=O |
| InChI | InChI=1S/C18H35NO4/c1-16(2)13-22-11-5-7-18(21,9-10-19-15-20)8-6-12-23-14-17(3)4/h16-17,21H,5-14H2,1-4H3 |
| InChIKey | SYIJRQGVLIRITD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|