C15H23N3O6 — CID 19378035
1,2,3-tris(3-isocyanatopropoxy)propane (PubChem CID 19378035) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is 1,2,3-tris(3-isocyanatopropoxy)propane.
| Compound Name | 1,2,3-tris(3-isocyanatopropoxy)propane |
|---|---|
| PubChem CID | 19378035 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1,2,3-tris(3-isocyanatopropoxy)propane |
| SMILES | O=C=NCCCOCC(COCCCN=C=O)OCCCN=C=O |
| InChI | InChI=1S/C15H23N3O6/c19-12-16-4-1-7-22-10-15(24-9-3-6-18-14-21)11-23-8-2-5-17-13-20/h15H,1-11H2 |
| InChIKey | PBLSOOZKCRGAFN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|