About 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine
7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine (PubChem CID 151930866) has the molecular formula C7H6FN3
and a molecular weight of 151.14 g/mol. Its IUPAC name is 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine |
| PubChem CID | 151930866 |
| Molecular Formula | C7H6FN3 |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine |
| SMILES | Nc1cnc2c(c1F)=NCC=2 |
| InChI | InChI=1S/C7H6FN3/c8-6-4(9)3-11-5-1-2-10-7(5)6/h1,3H,2,9H2 |
| InChIKey | SYTJABSYKQRKIW-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine?
The IUPAC name of 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine (CID 151930866) is 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine.
What is the SMILES notation for 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine?
The canonical SMILES for 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine is Nc1cnc2c(c1F)=NCC=2.
What is the InChIKey of 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine?
The InChIKey is SYTJABSYKQRKIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FN3/c8-6-4(9)3-11-5-1-2-10-7(5)6/h1,3H,2,9H2.
What are the key properties of 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine?
7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine has a molecular weight of 151.14 g/mol, XLogP of -0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine is sourced from PubChem (CID 151930866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).