About 2H-pyrrolo[3,2-b]pyridin-4-ium
2H-pyrrolo[3,2-b]pyridin-4-ium (PubChem CID 163666256) has the molecular formula C7H7N2+
and a molecular weight of 119.15 g/mol. Its IUPAC name is 2H-pyrrolo[3,2-b]pyridin-4-ium.
Molecular Properties
| Compound Name | 2H-pyrrolo[3,2-b]pyridin-4-ium |
| PubChem CID | 163666256 |
| Molecular Formula | C7H7N2+ |
| Molecular Weight | 119.15 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 2H-pyrrolo[3,2-b]pyridin-4-ium |
| SMILES | C1=c2[nH+]cccc2=NC1 |
| InChI | InChI=1S/C7H6N2/c1-2-6-7(8-4-1)3-5-9-6/h1-4H,5H2/p+1 |
| InChIKey | FQZLUNNSILEMNS-UHFFFAOYSA-O |
| XLogP | -1.09 |
| TPSA | 26.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.15 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-pyrrolo[3,2-b]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrrolo[3,2-b]pyridin-4-ium?
The IUPAC name of 2H-pyrrolo[3,2-b]pyridin-4-ium (CID 163666256) is 2H-pyrrolo[3,2-b]pyridin-4-ium.
What is the SMILES notation for 2H-pyrrolo[3,2-b]pyridin-4-ium?
The canonical SMILES for 2H-pyrrolo[3,2-b]pyridin-4-ium is C1=c2[nH+]cccc2=NC1.
What is the InChIKey of 2H-pyrrolo[3,2-b]pyridin-4-ium?
The InChIKey is FQZLUNNSILEMNS-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H6N2/c1-2-6-7(8-4-1)3-5-9-6/h1-4H,5H2/p+1.
What are the key properties of 2H-pyrrolo[3,2-b]pyridin-4-ium?
2H-pyrrolo[3,2-b]pyridin-4-ium has a molecular weight of 119.15 g/mol, XLogP of -1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrrolo[3,2-b]pyridin-4-ium is sourced from PubChem (CID 163666256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).