About zinc bis(8H-quinolin-8-ide)
zinc bis(8H-quinolin-8-ide) (PubChem CID 151932686) has the molecular formula C18H12N2Zn
and a molecular weight of 321.70 g/mol. Its IUPAC name is zinc bis(8H-quinolin-8-ide).
Molecular Properties
| Compound Name | zinc bis(8H-quinolin-8-ide) |
| PubChem CID | 151932686 |
| Molecular Formula | C18H12N2Zn |
| Molecular Weight | 321.70 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | zinc bis(8H-quinolin-8-ide) |
| SMILES | [Zn+2].[c-]1cccc2cccnc12.[c-]1cccc2cccnc12 |
| InChI | InChI=1S/2C9H6N.Zn/c2*1-2-6-9-8(4-1)5-3-7-10-9;/h2*1-5,7H;/q2*-1;+2 |
| InChIKey | HXJBOFXAGQKMRU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.70 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(8H-quinolin-8-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(8H-quinolin-8-ide)?
The IUPAC name of zinc bis(8H-quinolin-8-ide) (CID 151932686) is zinc bis(8H-quinolin-8-ide).
What is the SMILES notation for zinc bis(8H-quinolin-8-ide)?
The canonical SMILES for zinc bis(8H-quinolin-8-ide) is [Zn+2].[c-]1cccc2cccnc12.[c-]1cccc2cccnc12.
What is the InChIKey of zinc bis(8H-quinolin-8-ide)?
The InChIKey is HXJBOFXAGQKMRU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H6N.Zn/c2*1-2-6-9-8(4-1)5-3-7-10-9;/h2*1-5,7H;/q2*-1;+2.
What are the key properties of zinc bis(8H-quinolin-8-ide)?
zinc bis(8H-quinolin-8-ide) has a molecular weight of 321.70 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(8H-quinolin-8-ide) is sourced from PubChem (CID 151932686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).