C33H36N2O2 — CID 151940717
[2-[1-amino-6-(diethylamino)-2-(2,4-dimethylphenyl)-3-methyl-9H-xanthen-9-yl]phenyl]methanol (PubChem CID 151940717) has the molecular formula C33H36N2O2 and a molecular weight of 492.66 g/mol. Its IUPAC name is [2-[1-amino-6-(diethylamino)-2-(2,4-dimethylphenyl)-3-methyl-9H-xanthen-9-yl]phenyl]methanol.
| Compound Name | [2-[1-amino-6-(diethylamino)-2-(2,4-dimethylphenyl)-3-methyl-9H-xanthen-9-yl]phenyl]methanol |
|---|---|
| PubChem CID | 151940717 |
| Molecular Formula | C33H36N2O2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | [2-[1-amino-6-(diethylamino)-2-(2,4-dimethylphenyl)-3-methyl-9H-xanthen-9-yl]phenyl]methanol |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(C)c(-c3ccc(C)cc3C)c(N)c1C2c1ccccc1CO |
| InChI | InChI=1S/C33H36N2O2/c1-6-35(7-2)24-13-15-27-28(18-24)37-29-17-22(5)30(25-14-12-20(3)16-21(25)4)33(34)32(29)31(27)26-11-9-8-10-23(26)19-36/h8-18,31,36H,6-7,19,34H2,1-5H3 |
| InChIKey | TUPPACFFWRLRKN-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|