C7H6N2O — CID 151947586
1,3-dihydropyrrolo[3,4-b]pyridin-2-one (PubChem CID 151947586) has the molecular formula C7H6N2O and a molecular weight of 134.14 g/mol. Its IUPAC name is 1,3-dihydropyrrolo[3,4-b]pyridin-2-one.
| Compound Name | 1,3-dihydropyrrolo[3,4-b]pyridin-2-one |
|---|---|
| PubChem CID | 151947586 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1,3-dihydropyrrolo[3,4-b]pyridin-2-one |
| SMILES | O=C1CC=C2C=NC=C2N1 |
| InChI | InChI=1S/C7H6N2O/c10-7-2-1-5-3-8-4-6(5)9-7/h1,3-4H,2H2,(H,9,10) |
| InChIKey | TVYSDKJUWDRDFG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |