C17H19BrF3NO4 — CID 151952683
ethyl 2-(3-bromo-2,4,5-trifluorobenzoyl)-3-ethoxypiperidine-1-carboxylate (PubChem CID 151952683) has the molecular formula C17H19BrF3NO4 and a molecular weight of 438.24 g/mol. Its IUPAC name is ethyl 2-(3-bromo-2,4,5-trifluorobenzoyl)-3-ethoxypiperidine-1-carboxylate.
| Compound Name | ethyl 2-(3-bromo-2,4,5-trifluorobenzoyl)-3-ethoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 151952683 |
| Molecular Formula | C17H19BrF3NO4 |
| Molecular Weight | 438.24 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | ethyl 2-(3-bromo-2,4,5-trifluorobenzoyl)-3-ethoxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(OCC)C1C(=O)c1cc(F)c(F)c(Br)c1F |
| InChI | InChI=1S/C17H19BrF3NO4/c1-3-25-11-6-5-7-22(17(24)26-4-2)15(11)16(23)9-8-10(19)14(21)12(18)13(9)20/h8,11,15H,3-7H2,1-2H3 |
| InChIKey | TWZJNCJKFSYBEA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|