C22H21BrFNO4 — CID 175568519
1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione (PubChem CID 175568519) has the molecular formula C22H21BrFNO4 and a molecular weight of 462.32 g/mol. Its IUPAC name is 1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione.
| Compound Name | 1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 175568519 |
| Molecular Formula | C22H21BrFNO4 |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-6-(3-bromo-5-fluorophenyl)hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)N1C(=O)OCC1Cc1ccccc1)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C22H21BrFNO4/c23-17-11-16(12-18(24)13-17)20(26)8-4-5-9-21(27)25-19(14-29-22(25)28)10-15-6-2-1-3-7-15/h1-3,6-7,11-13,19H,4-5,8-10,14H2 |
| InChIKey | QISSNRNNQBMOJH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|