C14H16O4 — CID 151953469
5-hept-6-ynyl-2,3-dihydroxybenzoic acid (PubChem CID 151953469) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 5-hept-6-ynyl-2,3-dihydroxybenzoic acid.
| Compound Name | 5-hept-6-ynyl-2,3-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 151953469 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-hept-6-ynyl-2,3-dihydroxybenzoic acid |
| SMILES | C#CCCCCCc1cc(O)c(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H16O4/c1-2-3-4-5-6-7-10-8-11(14(17)18)13(16)12(15)9-10/h1,8-9,15-16H,3-7H2,(H,17,18) |
| InChIKey | TXDKXSGJVXRPGG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|