C19H16F7N2O3P — CID 151973157
2-[diphenoxyphosphorylmethyl(1,1,2,2,4,4,4-heptafluorobutyl)amino]acetonitrile (PubChem CID 151973157) has the molecular formula C19H16F7N2O3P and a molecular weight of 484.31 g/mol. Its IUPAC name is 2-[diphenoxyphosphorylmethyl(1,1,2,2,4,4,4-heptafluorobutyl)amino]acetonitrile.
| Compound Name | 2-[diphenoxyphosphorylmethyl(1,1,2,2,4,4,4-heptafluorobutyl)amino]acetonitrile |
|---|---|
| PubChem CID | 151973157 |
| Molecular Formula | C19H16F7N2O3P |
| Molecular Weight | 484.31 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 2-[diphenoxyphosphorylmethyl(1,1,2,2,4,4,4-heptafluorobutyl)amino]acetonitrile |
| SMILES | N#CCN(CP(=O)(Oc1ccccc1)Oc1ccccc1)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C19H16F7N2O3P/c20-17(21,13-18(22,23)24)19(25,26)28(12-11-27)14-32(29,30-15-7-3-1-4-8-15)31-16-9-5-2-6-10-16/h1-10H,12-14H2 |
| InChIKey | UBCHQROGWPDKRB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.31 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|