C21H32FN — CID 151975113
4-(12,12-dimethyltridec-1-ynyl)-2-fluoroaniline (PubChem CID 151975113) has the molecular formula C21H32FN and a molecular weight of 317.49 g/mol. Its IUPAC name is 4-(12,12-dimethyltridec-1-ynyl)-2-fluoroaniline.
| Compound Name | 4-(12,12-dimethyltridec-1-ynyl)-2-fluoroaniline |
|---|---|
| PubChem CID | 151975113 |
| Molecular Formula | C21H32FN |
| Molecular Weight | 317.49 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 4-(12,12-dimethyltridec-1-ynyl)-2-fluoroaniline |
| SMILES | CC(C)(C)CCCCCCCCCC#Cc1ccc(N)c(F)c1 |
| InChI | InChI=1S/C21H32FN/c1-21(2,3)16-12-10-8-6-4-5-7-9-11-13-18-14-15-20(23)19(22)17-18/h14-15,17H,4-10,12,16,23H2,1-3H3 |
| InChIKey | UBMOWRKLGDINGI-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.49 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|