About 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine
1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine (PubChem CID 15198021) has the molecular formula C24H26N2O2
and a molecular weight of 374.48 g/mol. Its IUPAC name is 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine.
Molecular Properties
| Compound Name | 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine |
| PubChem CID | 15198021 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine |
| SMILES | NC1C2CC3CC(C2)CC1(OCc1ccc(-c2nc4ccccc4o2)cc1)C3 |
| InChI | InChI=1S/C24H26N2O2/c25-22-19-10-16-9-17(11-19)13-24(22,12-16)27-14-15-5-7-18(8-6-15)23-26-20-3-1-2-4-21(20)28-23/h1-8,16-17,19,22H,9-14,25H2 |
| InChIKey | ZEUVNTQFKFRPIC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine?
The IUPAC name of 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine (CID 15198021) is 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine.
What is the SMILES notation for 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine?
The canonical SMILES for 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine is NC1C2CC3CC(C2)CC1(OCc1ccc(-c2nc4ccccc4o2)cc1)C3.
What is the InChIKey of 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine?
The InChIKey is ZEUVNTQFKFRPIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O2/c25-22-19-10-16-9-17(11-19)13-24(22,12-16)27-14-15-5-7-18(8-6-15)23-26-20-3-1-2-4-21(20)28-23/h1-8,16-17,19,22H,9-14,25H2.
What are the key properties of 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine?
1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine has a molecular weight of 374.48 g/mol, XLogP of 4.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]adamantan-2-amine is sourced from PubChem (CID 15198021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).