C25H29FO2S — CID 151992432
(8R,9S,10R,13S,14S)-7-[(4-fluorophenyl)sulfanylmethyl]-13-methyl-7,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 151992432) has the molecular formula C25H29FO2S and a molecular weight of 412.57 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-7-[(4-fluorophenyl)sulfanylmethyl]-13-methyl-7,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,10R,13S,14S)-7-[(4-fluorophenyl)sulfanylmethyl]-13-methyl-7,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 151992432 |
| Molecular Formula | C25H29FO2S |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (8R,9S,10R,13S,14S)-7-[(4-fluorophenyl)sulfanylmethyl]-13-methyl-7,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H](C(CSc4ccc(F)cc4)C=C4C=C(O)C=C[C@@H]43)[C@@H]1CCC2O |
| InChI | InChI=1S/C25H29FO2S/c1-25-11-10-21-20-7-4-18(27)13-15(20)12-16(24(21)22(25)8-9-23(25)28)14-29-19-5-2-17(26)3-6-19/h2-7,12-13,16,20-24,27-28H,8-11,14H2,1H3/t16?,20-,21+,22-,23?,24+,25-/m0/s1 |
| InChIKey | UEYOWCFUUHVCRI-JFKUIQCWSA-N |
| XLogP | 5.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |