C34H56O2 — CID 91344983
(7S,8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-7-[(4R,8R)-4,8,12-trimethyltridecyl]-7,8,9,10,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one (PubChem CID 91344983) has the molecular formula C34H56O2 and a molecular weight of 496.82 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-7-[(4R,8R)-4,8,12-trimethyltridecyl]-7,8,9,10,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (7S,8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-7-[(4R,8R)-4,8,12-trimethyltridecyl]-7,8,9,10,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91344983 |
| Molecular Formula | C34H56O2 |
| Molecular Weight | 496.82 g/mol |
| Exact Mass | 496.43 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-7-[(4R,8R)-4,8,12-trimethyltridecyl]-7,8,9,10,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@@H]1C=C2CC(=O)C=C[C@@H]2[C@H]2CC[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]21 |
| InChI | InChI=1S/C34H56O2/c1-23(2)9-6-10-24(3)11-7-12-25(4)13-8-14-26-21-27-22-28(35)15-16-29(27)30-19-20-34(5)31(33(26)30)17-18-32(34)36/h15-16,21,23-26,29-33,36H,6-14,17-20,22H2,1-5H3/t24-,25-,26-,29+,30-,31+,32+,33-,34+/m1/s1 |
| InChIKey | REKXAIPYFNCIPB-TXFMUSTMSA-N |
| XLogP | 8.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.82 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|