C10H15N5O4S — CID 15200587
methyl (3E)-3-(methoxycarbonylhydrazinylidene)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]butanoate (PubChem CID 15200587) has the molecular formula C10H15N5O4S and a molecular weight of 301.33 g/mol. Its IUPAC name is methyl (3E)-3-(methoxycarbonylhydrazinylidene)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]butanoate.
| Compound Name | methyl (3E)-3-(methoxycarbonylhydrazinylidene)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 15200587 |
| Molecular Formula | C10H15N5O4S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | methyl (3E)-3-(methoxycarbonylhydrazinylidene)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]butanoate |
| SMILES | COC(=O)N/N=C(\C)C(Sc1nncn1C)C(=O)OC |
| InChI | InChI=1S/C10H15N5O4S/c1-6(12-14-10(17)19-4)7(8(16)18-3)20-9-13-11-5-15(9)2/h5,7H,1-4H3,(H,14,17)/b12-6+ |
| InChIKey | MRHIPJFYNXVAQR-WUXMJOGZSA-N |
| XLogP | 0.18 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|