C23H23NO2 — CID 15203615
3-hydroxy-4,4-dimethyl-2,5,5-triphenyl-1,3-oxazolidine (PubChem CID 15203615) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-hydroxy-4,4-dimethyl-2,5,5-triphenyl-1,3-oxazolidine.
| Compound Name | 3-hydroxy-4,4-dimethyl-2,5,5-triphenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 15203615 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-hydroxy-4,4-dimethyl-2,5,5-triphenyl-1,3-oxazolidine |
| SMILES | CC1(C)N(O)C(c2ccccc2)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO2/c1-22(2)23(19-14-8-4-9-15-19,20-16-10-5-11-17-20)26-21(24(22)25)18-12-6-3-7-13-18/h3-17,21,25H,1-2H3 |
| InChIKey | WXUMWBQUPZAKSB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |