C30H37P — CID 15204396
[(E,2S,5R)-2-methyl-5-phenylundec-3-enyl]-diphenylphosphane (PubChem CID 15204396) has the molecular formula C30H37P and a molecular weight of 428.60 g/mol. Its IUPAC name is [(E,2S,5R)-2-methyl-5-phenylundec-3-enyl]-diphenylphosphane.
| Compound Name | [(E,2S,5R)-2-methyl-5-phenylundec-3-enyl]-diphenylphosphane |
|---|---|
| PubChem CID | 15204396 |
| Molecular Formula | C30H37P |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | [(E,2S,5R)-2-methyl-5-phenylundec-3-enyl]-diphenylphosphane |
| SMILES | CCCCCC[C@H](/C=C/[C@H](C)CP(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H37P/c1-3-4-5-9-18-28(27-16-10-6-11-17-27)24-23-26(2)25-31(29-19-12-7-13-20-29)30-21-14-8-15-22-30/h6-8,10-17,19-24,26,28H,3-5,9,18,25H2,1-2H3/b24-23+/t26-,28+/m0/s1 |
| InChIKey | GTUXDMQVPLYJMP-KLGWQTIBSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|